|
Product Details:
|
| Product Name: | 98% DSIP Cas 62568-57-4 | Active Ingredient: | DSIP |
|---|---|---|---|
| Packing: | 25kg/Drum | Specification: | 98% |
| Function: | Research | Appearance: | White Lyophilized Powder |
| Sample: | Available | Test Method: | HPLC |
| Highlight: | 10Mg/Bottle Delta Sleep Inducing Peptide,98% Dsip Peptide,Dsip Growth Hormone |
||
Penicillin Bottle Packing 98% Dsip Cas 62568-57-4 10 Mg/Bottle Sleep Inducing Peptide
What is DSIP?
| Chinese name | 依米地肽 |
| other name | DSIP Dsip WAGGDASGE EMIDELTIDE SLEEP INDUCING PEPTIDE DELTA SLEEP INDUCING PEPTIDE DELTA SLEEP-INDUCING PEPTIDE 4H2O TRP-ALA-GLY-GLY-ASN-ALA-SER-GLY-GLU TRP-ALA-GLY-GLY-ASP-ALA-SER-GLY-GLU trp-ala-gly-gly-asp-ala-ser-gly-glu TRP-ALA-GLY-GLY-ASP-ALA-SER-GLY-GLU 4H2O tryptophylalanylglycylglycyl-alpha-aspartylalanylserylglycylglutamic acid L-tryptophyl-L-alanylglycylglycyl-L-alpha-aspartyl-L-alanyl-L-serylglycyl-L-glutamic acid |
| CAS | 62568-57-4 |
| EINECS | 211-519-9 |
| chemical formula | C35H48N10O15 |
| molecular weight | 848.82 |
| InChI | InChI=1/C35H48N10O15/c1-16(41-32(56)20(36)9-18-11-37-21-6-4-3-5-19(18)21)30(54)39-12-25(47)38-13-26(48)44-23(10-29(52)53)34(58)42-17(2)31(55)45-24(15-46)33(57)40-14-27(49)43-22(35(59)60)7-8-28(50)51/h3-6,11,16-17,20,22-24,37,46H,7-10,12-15,36H2,1-2H3,(H,38,47)(H,39,54)(H,40,57)(H,41,56)(H,42,58)(H,43,49)(H,44,48)(H,45,55)(H,50,51)(H,52,53)(H,59,60) |
| density | 1.458±0.06 g/cm3(Predicted) |
| boiling point | 1522.7±65.0 °C(Predicted) |
| water solubility | Soluble in water at 0.5mg/ml |
Function
Emiditide is a neuropeptide that has antioxidant and anti-anxiety effects.
Contact Person: Eric from China
Tel: +8615829683015